C14H21ClN2O3S — CID 47057115
3-[2-[1-(3-chlorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide (PubChem CID 47057115) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 3-[2-[1-(3-chlorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide.
| Compound Name | 3-[2-[1-(3-chlorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 47057115 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-[2-[1-(3-chlorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)CCS(=O)(=O)CCC(N)=O |
| InChI | InChI=1S/C14H21ClN2O3S/c1-11(12-4-3-5-13(15)10-12)17(2)7-9-21(19,20)8-6-14(16)18/h3-5,10-11H,6-9H2,1-2H3,(H2,16,18) |
| InChIKey | FRFSDRUPIBYZMC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |