C16H26ClNO2 — CID 63630291
N-[1-(3-chlorophenyl)ethyl]-3,3-diethoxy-N-methylpropan-1-amine (PubChem CID 63630291) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-3,3-diethoxy-N-methylpropan-1-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-3,3-diethoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63630291 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-3,3-diethoxy-N-methylpropan-1-amine |
| SMILES | CCOC(CCN(C)C(C)c1cccc(Cl)c1)OCC |
| InChI | InChI=1S/C16H26ClNO2/c1-5-19-16(20-6-2)10-11-18(4)13(3)14-8-7-9-15(17)12-14/h7-9,12-13,16H,5-6,10-11H2,1-4H3 |
| InChIKey | MHMGGSKLVHIYJM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|