C15H20BrNO2 — CID 97355525
ethyl (2S)-2-(2-bromophenyl)-2-piperidin-1-ylacetate (PubChem CID 97355525) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is ethyl (2S)-2-(2-bromophenyl)-2-piperidin-1-ylacetate.
| Compound Name | ethyl (2S)-2-(2-bromophenyl)-2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 97355525 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | ethyl (2S)-2-(2-bromophenyl)-2-piperidin-1-ylacetate |
| SMILES | CCOC(=O)[C@H](c1ccccc1Br)N1CCCCC1 |
| InChI | InChI=1S/C15H20BrNO2/c1-2-19-15(18)14(17-10-6-3-7-11-17)12-8-4-5-9-13(12)16/h4-5,8-9,14H,2-3,6-7,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | YEPHONYFZKLGLZ-AWEZNQCLSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |