C17H24ClNO2 — CID 97355442
[(2S)-butan-2-yl] (2R)-2-(2-chlorophenyl)-2-piperidin-1-ylacetate (PubChem CID 97355442) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (2R)-2-(2-chlorophenyl)-2-piperidin-1-ylacetate.
| Compound Name | [(2S)-butan-2-yl] (2R)-2-(2-chlorophenyl)-2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 97355442 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [(2S)-butan-2-yl] (2R)-2-(2-chlorophenyl)-2-piperidin-1-ylacetate |
| SMILES | CC[C@H](C)OC(=O)[C@@H](c1ccccc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C17H24ClNO2/c1-3-13(2)21-17(20)16(19-11-7-4-8-12-19)14-9-5-6-10-15(14)18/h5-6,9-10,13,16H,3-4,7-8,11-12H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | PKAKWGOWJXXOHO-XJKSGUPXSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |