C16H21Cl2NO2 — CID 97355454
propyl (2S)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetate (PubChem CID 97355454) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.26 g/mol. Its IUPAC name is propyl (2S)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetate.
| Compound Name | propyl (2S)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 97355454 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | propyl (2S)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetate |
| SMILES | CCCOC(=O)[C@H](c1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-2-10-21-16(20)15(19-8-4-3-5-9-19)13-7-6-12(17)11-14(13)18/h6-7,11,15H,2-5,8-10H2,1H3/t15-/m0/s1 |
| InChIKey | ULZPBJFEPSKMKF-HNNXBMFYSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |