C13H15Cl2NO2 — CID 93297834
(2R)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetic acid (PubChem CID 93297834) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetic acid.
| Compound Name | (2R)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetic acid |
|---|---|
| PubChem CID | 93297834 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenyl)-2-piperidin-1-ylacetic acid |
| SMILES | O=C(O)[C@@H](c1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H15Cl2NO2/c14-9-4-5-10(11(15)8-9)12(13(17)18)16-6-2-1-3-7-16/h4-5,8,12H,1-3,6-7H2,(H,17,18)/t12-/m1/s1 |
| InChIKey | DHWQRWLBQISUPU-GFCCVEGCSA-N |
| XLogP | 3.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |