C14H17Cl2NO2 — CID 3945055
1-[1-(2,4-dichlorophenyl)ethyl]piperidine-4-carboxylic acid (PubChem CID 3945055) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3945055 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]piperidine-4-carboxylic acid |
| SMILES | CC(c1ccc(Cl)cc1Cl)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-9(12-3-2-11(15)8-13(12)16)17-6-4-10(5-7-17)14(18)19/h2-3,8-10H,4-7H2,1H3,(H,18,19) |
| InChIKey | OHBHXJVFNOHFOR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |