C14H20Cl2N2 — CID 112630096
1-[1-[1-(2,4-dichlorophenyl)ethyl]pyrrolidin-3-yl]ethanamine (PubChem CID 112630096) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[1-[1-(2,4-dichlorophenyl)ethyl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-[1-(2,4-dichlorophenyl)ethyl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 112630096 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[1-[1-(2,4-dichlorophenyl)ethyl]pyrrolidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCN(C(C)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H20Cl2N2/c1-9(17)11-5-6-18(8-11)10(2)13-4-3-12(15)7-14(13)16/h3-4,7,9-11H,5-6,8,17H2,1-2H3 |
| InChIKey | GKVCPXSUBDOAGS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |