C15H24Cl2N2 — CID 119925793
1-[1-[1-(3-chlorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 119925793) has the molecular formula C15H24Cl2N2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 1-[1-[1-(3-chlorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[1-(3-chlorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119925793 |
| Molecular Formula | C15H24Cl2N2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[1-[1-(3-chlorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(C(C)c2cccc(Cl)c2)C1.Cl |
| InChI | InChI=1S/C15H23ClN2.ClH/c1-11(17)14-6-4-8-18(10-14)12(2)13-5-3-7-15(16)9-13;/h3,5,7,9,11-12,14H,4,6,8,10,17H2,1-2H3;1H |
| InChIKey | NMZPKIHAPOQYPH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |