C12H18Cl2N2 — CID 119905419
(3R)-1-[1-(3-chlorophenyl)ethyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 119905419) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is (3R)-1-[1-(3-chlorophenyl)ethyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-[1-(3-chlorophenyl)ethyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119905419 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (3R)-1-[1-(3-chlorophenyl)ethyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(c1cccc(Cl)c1)N1CC[C@@H](N)C1.Cl |
| InChI | InChI=1S/C12H17ClN2.ClH/c1-9(15-6-5-12(14)8-15)10-3-2-4-11(13)7-10;/h2-4,7,9,12H,5-6,8,14H2,1H3;1H/t9?,12-;/m1./s1 |
| InChIKey | HOUBNWOAKAFILL-ZHWMGRLRSA-N |
| XLogP | 2.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |