C15H22BrFN2 — CID 82970687
1-[1-[1-(4-bromo-2-fluorophenyl)ethyl]piperidin-3-yl]ethanamine (PubChem CID 82970687) has the molecular formula C15H22BrFN2 and a molecular weight of 329.26 g/mol. Its IUPAC name is 1-[1-[1-(4-bromo-2-fluorophenyl)ethyl]piperidin-3-yl]ethanamine.
| Compound Name | 1-[1-[1-(4-bromo-2-fluorophenyl)ethyl]piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 82970687 |
| Molecular Formula | C15H22BrFN2 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[1-[1-(4-bromo-2-fluorophenyl)ethyl]piperidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCCN(C(C)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H22BrFN2/c1-10(18)12-4-3-7-19(9-12)11(2)14-6-5-13(16)8-15(14)17/h5-6,8,10-12H,3-4,7,9,18H2,1-2H3 |
| InChIKey | YDIJGTMMTFXFIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |