C15H20BrFN2O2 — CID 124592217
1-[(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-2-(4-bromo-2-fluorophenoxy)ethanone (PubChem CID 124592217) has the molecular formula C15H20BrFN2O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is 1-[(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-2-(4-bromo-2-fluorophenoxy)ethanone.
| Compound Name | 1-[(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-2-(4-bromo-2-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 124592217 |
| Molecular Formula | C15H20BrFN2O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[(3R)-3-[(1S)-1-aminoethyl]piperidin-1-yl]-2-(4-bromo-2-fluorophenoxy)ethanone |
| SMILES | C[C@H](N)[C@@H]1CCCN(C(=O)COc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H20BrFN2O2/c1-10(18)11-3-2-6-19(8-11)15(20)9-21-14-5-4-12(16)7-13(14)17/h4-5,7,10-11H,2-3,6,8-9,18H2,1H3/t10-,11+/m0/s1 |
| InChIKey | TYYAQXAKTNZVLD-WDEREUQCSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |