About 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid
1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid (PubChem CID 106745319) has the molecular formula C15H19Cl2NO2
and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid |
| PubChem CID | 106745319 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1C(C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO2/c1-9-7-11(15(19)20)5-6-18(9)10(2)13-8-12(16)3-4-14(13)17/h3-4,8-11H,5-7H2,1-2H3,(H,19,20) |
| InChIKey | VUCDXGRKQZVVKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid (CID 106745319) is 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid is CC1CC(C(=O)O)CCN1C(C)c1cc(Cl)ccc1Cl.
What is the InChIKey of 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid?
The InChIKey is VUCDXGRKQZVVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO2/c1-9-7-11(15(19)20)5-6-18(9)10(2)13-8-12(16)3-4-14(13)17/h3-4,8-11H,5-7H2,1-2H3,(H,19,20).
What are the key properties of 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid?
1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid has a molecular weight of 316.23 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,5-dichlorophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 106745319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).