C15H20INO2 — CID 114083273
1-[1-(4-iodophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid (PubChem CID 114083273) has the molecular formula C15H20INO2 and a molecular weight of 373.23 g/mol. Its IUPAC name is 1-[1-(4-iodophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-[1-(4-iodophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 114083273 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[1-(4-iodophenyl)ethyl]-2-methylpiperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1C(C)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H20INO2/c1-10-9-13(15(18)19)7-8-17(10)11(2)12-3-5-14(16)6-4-12/h3-6,10-11,13H,7-9H2,1-2H3,(H,18,19) |
| InChIKey | XHPXKLUMUUSDGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|