C22H23ClN6O3 — CID 24668308
ethyl 2-(4-chlorophenyl)-2-[4-[2-(tetrazol-1-yl)benzoyl]piperazin-1-yl]acetate (PubChem CID 24668308) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-2-[4-[2-(tetrazol-1-yl)benzoyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-(4-chlorophenyl)-2-[4-[2-(tetrazol-1-yl)benzoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 24668308 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-2-[4-[2-(tetrazol-1-yl)benzoyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)c2ccccc2-n2cnnn2)CC1 |
| InChI | InChI=1S/C22H23ClN6O3/c1-2-32-22(31)20(16-7-9-17(23)10-8-16)27-11-13-28(14-12-27)21(30)18-5-3-4-6-19(18)29-15-24-25-26-29/h3-10,15,20H,2,11-14H2,1H3 |
| InChIKey | XLCOEZHSMFRYQP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |