C21H22ClN3O5 — CID 46604586
methyl 2-(4-chlorophenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetate (PubChem CID 46604586) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 46604586 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)c2ccc([N+](=O)[O-])c(C)c2)CC1 |
| InChI | InChI=1S/C21H22ClN3O5/c1-14-13-16(5-8-18(14)25(28)29)20(26)24-11-9-23(10-12-24)19(21(27)30-2)15-3-6-17(22)7-4-15/h3-8,13,19H,9-12H2,1-2H3 |
| InChIKey | BVAQQPCAWJAOBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|