C19H20ClN3O4 — CID 60509563
methyl 2-(4-chlorophenyl)-2-[4-(1-oxidopyridin-1-ium-2-carbonyl)piperazin-1-yl]acetate (PubChem CID 60509563) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-[4-(1-oxidopyridin-1-ium-2-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-[4-(1-oxidopyridin-1-ium-2-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 60509563 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-[4-(1-oxidopyridin-1-ium-2-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)c2cccc[n+]2[O-])CC1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-27-19(25)17(14-5-7-15(20)8-6-14)21-10-12-22(13-11-21)18(24)16-4-2-3-9-23(16)26/h2-9,17H,10-13H2,1H3 |
| InChIKey | NKQKZJAYLVPLDT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|