C20H19Cl2FN2O3 — CID 43063817
methyl 2-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate (PubChem CID 43063817) has the molecular formula C20H19Cl2FN2O3 and a molecular weight of 425.29 g/mol. Its IUPAC name is methyl 2-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate.
| Compound Name | methyl 2-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 43063817 |
| Molecular Formula | C20H19Cl2FN2O3 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl 2-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(4-chlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)c2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H19Cl2FN2O3/c1-28-20(27)18(13-2-4-14(21)5-3-13)24-8-10-25(11-9-24)19(26)16-7-6-15(23)12-17(16)22/h2-7,12,18H,8-11H2,1H3 |
| InChIKey | XOHKIMOXMWLWDN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |