C24H26Cl2N2O5 — CID 42946242
methyl 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(2-chlorophenyl)acetate (PubChem CID 42946242) has the molecular formula C24H26Cl2N2O5 and a molecular weight of 493.39 g/mol. Its IUPAC name is methyl 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(2-chlorophenyl)acetate.
| Compound Name | methyl 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 42946242 |
| Molecular Formula | C24H26Cl2N2O5 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | methyl 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]-2-(2-chlorophenyl)acetate |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCN(C(C(=O)OC)c3ccccc3Cl)CC2)cc(Cl)c1O |
| InChI | InChI=1S/C24H26Cl2N2O5/c1-3-33-20-15-16(14-19(26)23(20)30)8-9-21(29)27-10-12-28(13-11-27)22(24(31)32-2)17-6-4-5-7-18(17)25/h4-9,14-15,22,30H,3,10-13H2,1-2H3/b9-8+ |
| InChIKey | IFSFSZIRKJTCJK-CMDGGOBGSA-N |
| XLogP | 4.17 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|