C17H16F3N5O3 — CID 100767955
N'-[1-(2-cyanoethyl)pyrazol-3-yl]-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]oxamide (PubChem CID 100767955) has the molecular formula C17H16F3N5O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is N'-[1-(2-cyanoethyl)pyrazol-3-yl]-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]oxamide.
| Compound Name | N'-[1-(2-cyanoethyl)pyrazol-3-yl]-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 100767955 |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N'-[1-(2-cyanoethyl)pyrazol-3-yl]-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ccn(CCC#N)n2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N5O3/c1-11-3-4-12(13(9-11)28-10-17(18,19)20)22-15(26)16(27)23-14-5-8-25(24-14)7-2-6-21/h3-5,8-9H,2,7,10H2,1H3,(H,22,26)(H,23,24,27) |
| InChIKey | NPLRCXQJKJZMNE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|