C16H20FN3O4S — CID 74247635
(3aR,4R,7S,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 74247635) has the molecular formula C16H20FN3O4S and a molecular weight of 369.42 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7S,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 74247635 |
| Molecular Formula | C16H20FN3O4S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3aR,4R,7S,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(F)c(NC(=O)N2C[C@@H]3[C@H](C2)[C@H]2CC[C@@H]3O2)c1 |
| InChI | InChI=1S/C16H20FN3O4S/c1-25(22,23)19-9-2-3-12(17)13(6-9)18-16(21)20-7-10-11(8-20)15-5-4-14(10)24-15/h2-3,6,10-11,14-15,19H,4-5,7-8H2,1H3,(H,18,21)/t10-,11+,14+,15- |
| InChIKey | SOPGXMMVONWOAV-AGCIHXOGSA-N |
| XLogP | 1.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |