C12H17FN2O3S — CID 82727389
N-[2-fluoro-5-[(2-methyloxolan-3-yl)amino]phenyl]methanesulfonamide (PubChem CID 82727389) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[2-fluoro-5-[(2-methyloxolan-3-yl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-fluoro-5-[(2-methyloxolan-3-yl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 82727389 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[2-fluoro-5-[(2-methyloxolan-3-yl)amino]phenyl]methanesulfonamide |
| SMILES | CC1OCCC1Nc1ccc(F)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-8-11(5-6-18-8)14-9-3-4-10(13)12(7-9)15-19(2,16)17/h3-4,7-8,11,14-15H,5-6H2,1-2H3 |
| InChIKey | KSMXMFPSMONRIV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |