C14H20FN3O2S — CID 105364190
N-[5-(1-azabicyclo[3.2.1]octan-4-ylamino)-2-fluorophenyl]methanesulfonamide (PubChem CID 105364190) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[5-(1-azabicyclo[3.2.1]octan-4-ylamino)-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[5-(1-azabicyclo[3.2.1]octan-4-ylamino)-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 105364190 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[5-(1-azabicyclo[3.2.1]octan-4-ylamino)-2-fluorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(NC2CCN3CCC2C3)ccc1F |
| InChI | InChI=1S/C14H20FN3O2S/c1-21(19,20)17-14-8-11(2-3-12(14)15)16-13-5-7-18-6-4-10(13)9-18/h2-3,8,10,13,16-17H,4-7,9H2,1H3 |
| InChIKey | YWIHBMWGGPDETF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |