C13H17ClN2 — CID 105363660
N-(3-chlorophenyl)-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105363660) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-(3-chlorophenyl)-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 105363660 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-(3-chlorophenyl)-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | Clc1cccc(NC2CCN3CCC2C3)c1 |
| InChI | InChI=1S/C13H17ClN2/c14-11-2-1-3-12(8-11)15-13-5-7-16-6-4-10(13)9-16/h1-3,8,10,13,15H,4-7,9H2 |
| InChIKey | HOHTVPKLAFRQFU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |