C12H16ClN3 — CID 105364008
N-(2-chloro-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105364008) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-(2-chloro-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 105364008 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | Clc1ncccc1NC1CCN2CCC1C2 |
| InChI | InChI=1S/C12H16ClN3/c13-12-11(2-1-5-14-12)15-10-4-7-16-6-3-9(10)8-16/h1-2,5,9-10,15H,3-4,6-8H2 |
| InChIKey | AYTQUDXBYSVQNZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|