C14H20ClN3O2S — CID 105364063
N-[3-(1-azabicyclo[3.2.1]octan-4-ylamino)-4-chlorophenyl]methanesulfonamide (PubChem CID 105364063) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is N-[3-(1-azabicyclo[3.2.1]octan-4-ylamino)-4-chlorophenyl]methanesulfonamide.
| Compound Name | N-[3-(1-azabicyclo[3.2.1]octan-4-ylamino)-4-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 105364063 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[3-(1-azabicyclo[3.2.1]octan-4-ylamino)-4-chlorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cl)c(NC2CCN3CCC2C3)c1 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-21(19,20)17-11-2-3-12(15)14(8-11)16-13-5-7-18-6-4-10(13)9-18/h2-3,8,10,13,16-17H,4-7,9H2,1H3 |
| InChIKey | CTBKFYGMJSZFHQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |