C17H20F2N2O4 — CID 100616772
(3aR,4R,7R,7aR)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 100616772) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7R,7aR)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 100616772 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3aR,4R,7R,7aR)-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)N2C[C@H]3[C@H](C2)[C@H]2CC[C@H]3O2)cc1OC(F)F |
| InChI | InChI=1S/C17H20F2N2O4/c1-23-14-3-2-9(6-15(14)25-16(18)19)20-17(22)21-7-10-11(8-21)13-5-4-12(10)24-13/h2-3,6,10-13,16H,4-5,7-8H2,1H3,(H,20,22)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | DEZLTFVIGBRLIX-WUHRBBMRSA-N |
| XLogP | 2.94 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |