C19H26N2O3 — CID 129378260
(3aS,4R,7R,7aS)-N-[3-[(2S)-butan-2-yl]oxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 129378260) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-N-[3-[(2S)-butan-2-yl]oxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aS,4R,7R,7aS)-N-[3-[(2S)-butan-2-yl]oxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 129378260 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3aS,4R,7R,7aS)-N-[3-[(2S)-butan-2-yl]oxyphenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CC[C@H](C)Oc1cccc(NC(=O)N2C[C@@H]3[C@@H](C2)[C@H]2CC[C@H]3O2)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-3-12(2)23-14-6-4-5-13(9-14)20-19(22)21-10-15-16(11-21)18-8-7-17(15)24-18/h4-6,9,12,15-18H,3,7-8,10-11H2,1-2H3,(H,20,22)/t12-,15+,16+,17+,18+/m0/s1 |
| InChIKey | NZPMLIMUCAFKER-DYTBSURPSA-N |
| XLogP | 3.51 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |