C18H24N2O3 — CID 129378263
(3aR,4R,7R,7aR)-N-(3-ethoxy-4-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 129378263) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-N-(3-ethoxy-4-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7R,7aR)-N-(3-ethoxy-4-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 129378263 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3aR,4R,7R,7aR)-N-(3-ethoxy-4-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)N2C[C@H]3[C@H](C2)[C@H]2CC[C@H]3O2)ccc1C |
| InChI | InChI=1S/C18H24N2O3/c1-3-22-17-8-12(5-4-11(17)2)19-18(21)20-9-13-14(10-20)16-7-6-15(13)23-16/h4-5,8,13-16H,3,6-7,9-10H2,1-2H3,(H,19,21)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | OVQDDBJRXAFIPG-CAOSSQGBSA-N |
| XLogP | 3.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |