C16H20FN3O3S — CID 74241927
(3aR,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 74241927) has the molecular formula C16H20FN3O3S and a molecular weight of 353.42 g/mol. Its IUPAC name is (3aR,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 74241927 |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (3aR,7aS)-N-[2-fluoro-5-(methanesulfonamido)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(F)c(NC(=O)N2C[C@H]3CC=CC[C@H]3C2)c1 |
| InChI | InChI=1S/C16H20FN3O3S/c1-24(22,23)19-13-6-7-14(17)15(8-13)18-16(21)20-9-11-4-2-3-5-12(11)10-20/h2-3,6-8,11-12,19H,4-5,9-10H2,1H3,(H,18,21)/t11-,12+ |
| InChIKey | OGJOFENKGZOKBT-TXEJJXNPSA-N |
| XLogP | 2.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|