C16H19FN2O — CID 72872228
(3aS,7aR)-N-(3-fluoro-4-methylphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 72872228) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is (3aS,7aR)-N-(3-fluoro-4-methylphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aS,7aR)-N-(3-fluoro-4-methylphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 72872228 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (3aS,7aR)-N-(3-fluoro-4-methylphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2C[C@H]3CC=CC[C@H]3C2)cc1F |
| InChI | InChI=1S/C16H19FN2O/c1-11-6-7-14(8-15(11)17)18-16(20)19-9-12-4-2-3-5-13(12)10-19/h2-3,6-8,12-13H,4-5,9-10H2,1H3,(H,18,20)/t12-,13+ |
| InChIKey | IRGNXSXSVBDIND-BETUJISGSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|