C17H20ClN3O2 — CID 71992327
N-(4-acetamido-2-chlorophenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 71992327) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is N-(4-acetamido-2-chlorophenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | N-(4-acetamido-2-chlorophenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 71992327 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-(4-acetamido-2-chlorophenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)N2CC3CC=CCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-11(22)19-14-6-7-16(15(18)8-14)20-17(23)21-9-12-4-2-3-5-13(12)10-21/h2-3,6-8,12-13H,4-5,9-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | QUNGHALLEPZIEE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|