C19H24N4O2 — CID 74230992
(3aR,7aS)-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 74230992) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3aR,7aS)-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 74230992 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3aR,7aS)-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | Cc1cc2c(cc1NC(=O)N1C[C@H]3CC=CC[C@H]3C1)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H24N4O2/c1-12-8-16-17(22(3)19(25)21(16)2)9-15(12)20-18(24)23-10-13-6-4-5-7-14(13)11-23/h4-5,8-9,13-14H,6-7,10-11H2,1-3H3,(H,20,24)/t13-,14+ |
| InChIKey | KXPXXRXODUBSPK-OKILXGFUSA-N |
| XLogP | 2.62 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|