C17H20N2O3 — CID 71992678
methyl 4-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonylamino)benzoate (PubChem CID 71992678) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 4-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonylamino)benzoate.
| Compound Name | methyl 4-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 71992678 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | methyl 4-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2CC3CC=CCC3C2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-22-16(20)12-6-8-15(9-7-12)18-17(21)19-10-13-4-2-3-5-14(13)11-19/h2-3,6-9,13-14H,4-5,10-11H2,1H3,(H,18,21) |
| InChIKey | DUEKXNUHHWAIAI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|