C18H17Cl2N3O3 — CID 86265406
N-(3,4-dichlorophenyl)-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)azetidine-1-carboxamide (PubChem CID 86265406) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)azetidine-1-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 86265406 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)azetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CC(N2C(=O)C3CC=CCC3C2=O)C1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c19-14-6-5-10(7-15(14)20)21-18(26)22-8-11(9-22)23-16(24)12-3-1-2-4-13(12)17(23)25/h1-2,5-7,11-13H,3-4,8-9H2,(H,21,26) |
| InChIKey | KBEMHZXRQUVTFF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|