C16H16F4N2O2 — CID 72882345
(3aR,4R,7S,7aS)-N-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 72882345) has the molecular formula C16H16F4N2O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-N-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7S,7aS)-N-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 72882345 |
| Molecular Formula | C16H16F4N2O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (3aR,4R,7S,7aS)-N-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(C(F)(F)F)c1)N1C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H16F4N2O2/c17-9-3-8(16(18,19)20)4-10(5-9)21-15(23)22-6-11-12(7-22)14-2-1-13(11)24-14/h3-5,11-14H,1-2,6-7H2,(H,21,23)/t11-,12+,13+,14- |
| InChIKey | PVOUTSZKMXZEMZ-LVEBTZEWSA-N |
| XLogP | 3.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |