C16H17F2NO2 — CID 56869344
[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone (PubChem CID 56869344) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone.
| Compound Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 56869344 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone |
| SMILES | Cc1ccc(F)c(C(=O)N2C[C@@H]3[C@H](C2)[C@H]2CC[C@@H]3O2)c1F |
| InChI | InChI=1S/C16H17F2NO2/c1-8-2-3-11(17)14(15(8)18)16(20)19-6-9-10(7-19)13-5-4-12(9)21-13/h2-3,9-10,12-13H,4-7H2,1H3/t9-,10+,12+,13- |
| InChIKey | OQRBEZODPLDBQP-QZHINBJYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |