C16H19F2NO3 — CID 56875020
[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone (PubChem CID 56875020) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone.
| Compound Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 56875020 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-difluoro-3-methylphenyl)methanone |
| SMILES | Cc1ccc(F)c(C(=O)N2C[C@H]3C[C@H](O)[C@@H](O)C[C@H]3C2)c1F |
| InChI | InChI=1S/C16H19F2NO3/c1-8-2-3-11(17)14(15(8)18)16(22)19-6-9-4-12(20)13(21)5-10(9)7-19/h2-3,9-10,12-13,20-21H,4-7H2,1H3/t9-,10+,12-,13-/m0/s1 |
| InChIKey | WMZQLFOYLGRKJQ-LFSVMHDDSA-N |
| XLogP | 1.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |