C14H16F2N2OS — CID 82815172
1-(2,6-difluoro-3-methylbenzoyl)piperidine-4-carbothioamide (PubChem CID 82815172) has the molecular formula C14H16F2N2OS and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylbenzoyl)piperidine-4-carbothioamide.
| Compound Name | 1-(2,6-difluoro-3-methylbenzoyl)piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 82815172 |
| Molecular Formula | C14H16F2N2OS |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(2,6-difluoro-3-methylbenzoyl)piperidine-4-carbothioamide |
| SMILES | Cc1ccc(F)c(C(=O)N2CCC(C(N)=S)CC2)c1F |
| InChI | InChI=1S/C14H16F2N2OS/c1-8-2-3-10(15)11(12(8)16)14(19)18-6-4-9(5-7-18)13(17)20/h2-3,9H,4-7H2,1H3,(H2,17,20) |
| InChIKey | PGUFBQLVPOUSPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|