C18H15Cl2F2N3O3S — CID 87481063
1-[6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-fluoro-1,3-benzothiazol-2-yl]-3-(2-hydroxyethyl)urea (PubChem CID 87481063) has the molecular formula C18H15Cl2F2N3O3S and a molecular weight of 462.31 g/mol. Its IUPAC name is 1-[6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-fluoro-1,3-benzothiazol-2-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-fluoro-1,3-benzothiazol-2-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 87481063 |
| Molecular Formula | C18H15Cl2F2N3O3S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 1-[6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-fluoro-1,3-benzothiazol-2-yl]-3-(2-hydroxyethyl)urea |
| SMILES | C[C@@H](Oc1cc2sc(NC(=O)NCCO)nc2cc1F)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H15Cl2F2N3O3S/c1-8(15-9(19)2-3-10(21)16(15)20)28-13-7-14-12(6-11(13)22)24-18(29-14)25-17(27)23-4-5-26/h2-3,6-8,26H,4-5H2,1H3,(H2,23,24,25,27)/t8-/m1/s1 |
| InChIKey | SUMHCTLIMCPEGL-MRVPVSSYSA-N |
| XLogP | 5.14 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|