C11H8Cl2FNO3S — CID 134180426
2-[(2-chloro-5-fluoro-1,3-benzothiazol-6-yl)oxy]propyl carbonochloridate (PubChem CID 134180426) has the molecular formula C11H8Cl2FNO3S and a molecular weight of 324.16 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluoro-1,3-benzothiazol-6-yl)oxy]propyl carbonochloridate.
| Compound Name | 2-[(2-chloro-5-fluoro-1,3-benzothiazol-6-yl)oxy]propyl carbonochloridate |
|---|---|
| PubChem CID | 134180426 |
| Molecular Formula | C11H8Cl2FNO3S |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2-[(2-chloro-5-fluoro-1,3-benzothiazol-6-yl)oxy]propyl carbonochloridate |
| SMILES | CC(COC(=O)Cl)Oc1cc2sc(Cl)nc2cc1F |
| InChI | InChI=1S/C11H8Cl2FNO3S/c1-5(4-17-11(13)16)18-8-3-9-7(2-6(8)14)15-10(12)19-9/h2-3,5H,4H2,1H3 |
| InChIKey | VVDHMVWSHNLZQT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|