C12H8BrCl2FN2O — CID 21111485
5-bromo-3-[(2,6-dichloro-3-fluorophenyl)methoxy]pyridin-2-amine (PubChem CID 21111485) has the molecular formula C12H8BrCl2FN2O and a molecular weight of 366.02 g/mol. Its IUPAC name is 5-bromo-3-[(2,6-dichloro-3-fluorophenyl)methoxy]pyridin-2-amine.
| Compound Name | 5-bromo-3-[(2,6-dichloro-3-fluorophenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 21111485 |
| Molecular Formula | C12H8BrCl2FN2O |
| Molecular Weight | 366.02 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 5-bromo-3-[(2,6-dichloro-3-fluorophenyl)methoxy]pyridin-2-amine |
| SMILES | Nc1ncc(Br)cc1OCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C12H8BrCl2FN2O/c13-6-3-10(12(17)18-4-6)19-5-7-8(14)1-2-9(16)11(7)15/h1-4H,5H2,(H2,17,18) |
| InChIKey | KFBVKSXSXBYYBA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.02 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|