C13H12BrFN2O2 — CID 21111328
5-bromo-3-[(3-fluoro-2-methoxyphenyl)methoxy]pyridin-2-amine (PubChem CID 21111328) has the molecular formula C13H12BrFN2O2 and a molecular weight of 327.15 g/mol. Its IUPAC name is 5-bromo-3-[(3-fluoro-2-methoxyphenyl)methoxy]pyridin-2-amine.
| Compound Name | 5-bromo-3-[(3-fluoro-2-methoxyphenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 21111328 |
| Molecular Formula | C13H12BrFN2O2 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 5-bromo-3-[(3-fluoro-2-methoxyphenyl)methoxy]pyridin-2-amine |
| SMILES | COc1c(F)cccc1COc1cc(Br)cnc1N |
| InChI | InChI=1S/C13H12BrFN2O2/c1-18-12-8(3-2-4-10(12)15)7-19-11-5-9(14)6-17-13(11)16/h2-6H,7H2,1H3,(H2,16,17) |
| InChIKey | MKSPAJNRSXRKBQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|