C19H16Cl2FN5O3 — CID 134261356
6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-(2-methoxy-4-pyridinyl)pyridazine-3-carboxamide (PubChem CID 134261356) has the molecular formula C19H16Cl2FN5O3 and a molecular weight of 452.27 g/mol. Its IUPAC name is 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-(2-methoxy-4-pyridinyl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-(2-methoxy-4-pyridinyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 134261356 |
| Molecular Formula | C19H16Cl2FN5O3 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-(2-methoxy-4-pyridinyl)pyridazine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(OCCc3c(Cl)ccc(F)c3Cl)c(N)nn2)ccn1 |
| InChI | InChI=1S/C19H16Cl2FN5O3/c1-29-16-8-10(4-6-24-16)25-19(28)14-9-15(18(23)27-26-14)30-7-5-11-12(20)2-3-13(22)17(11)21/h2-4,6,8-9H,5,7H2,1H3,(H2,23,27)(H,24,25,28) |
| InChIKey | DBGQMCJYGLSBDO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|