C19H16Cl2FN5O3 — CID 121408639
N-[6-amino-4-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-(6-methoxy-3-pyridinyl)formamide (PubChem CID 121408639) has the molecular formula C19H16Cl2FN5O3 and a molecular weight of 452.27 g/mol. Its IUPAC name is N-[6-amino-4-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-(6-methoxy-3-pyridinyl)formamide.
| Compound Name | N-[6-amino-4-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-(6-methoxy-3-pyridinyl)formamide |
|---|---|
| PubChem CID | 121408639 |
| Molecular Formula | C19H16Cl2FN5O3 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-[6-amino-4-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-(6-methoxy-3-pyridinyl)formamide |
| SMILES | COc1ccc(N(C=O)c2nnc(N)cc2OCCc2c(Cl)ccc(F)c2Cl)cn1 |
| InChI | InChI=1S/C19H16Cl2FN5O3/c1-29-17-5-2-11(9-24-17)27(10-28)19-15(8-16(23)25-26-19)30-7-6-12-13(20)3-4-14(22)18(12)21/h2-5,8-10H,6-7H2,1H3,(H2,23,25) |
| InChIKey | DLUZCNQNYUIBFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|