C19H18Cl2FN5O3 — CID 91126262
N-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-6-methoxy-2H-pyridine-1-carboxamide (PubChem CID 91126262) has the molecular formula C19H18Cl2FN5O3 and a molecular weight of 454.29 g/mol. Its IUPAC name is N-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-6-methoxy-2H-pyridine-1-carboxamide.
| Compound Name | N-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-6-methoxy-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 91126262 |
| Molecular Formula | C19H18Cl2FN5O3 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-6-methoxy-2H-pyridine-1-carboxamide |
| SMILES | COC1=CC=CCN1C(=O)Nc1cc(OCCc2c(Cl)ccc(F)c2Cl)c(N)nn1 |
| InChI | InChI=1S/C19H18Cl2FN5O3/c1-29-16-4-2-3-8-27(16)19(28)24-15-10-14(18(23)26-25-15)30-9-7-11-12(20)5-6-13(22)17(11)21/h2-6,10H,7-9H2,1H3,(H2,23,26)(H,24,25,28) |
| InChIKey | CSFSUCGHBRKHKK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|