C19H14Cl3FN2O — CID 91565843
N-(4-chlorophenyl)-N-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 91565843) has the molecular formula C19H14Cl3FN2O and a molecular weight of 411.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | N-(4-chlorophenyl)-N-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 91565843 |
| Molecular Formula | C19H14Cl3FN2O |
| Molecular Weight | 411.69 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | N-(4-chlorophenyl)-N-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | Fc1ccc(Cl)c(CCON(c2ccc(Cl)cc2)c2ccccn2)c1Cl |
| InChI | InChI=1S/C19H14Cl3FN2O/c20-13-4-6-14(7-5-13)25(18-3-1-2-11-24-18)26-12-10-15-16(21)8-9-17(23)19(15)22/h1-9,11H,10,12H2 |
| InChIKey | RPYJPQZOTMEGRC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|