C40H22BBr4Cl4F8N4O6 — CID 123793159
CID 123793159 (PubChem CID 123793159) has the molecular formula C40H22BBr4Cl4F8N4O6 and a molecular weight of 1278.86 g/mol.
| Compound Name | CID 123793159 |
|---|---|
| PubChem CID | 123793159 |
| Molecular Formula | C40H22BBr4Cl4F8N4O6 |
| Molecular Weight | 1278.86 g/mol |
| Exact Mass | 1272.70 |
| IUPAC Name | — |
| SMILES | Fc1ccc(Cl)c(CCON(c2ccccn2)c2c(Br)c(Br)cc(O[B]Oc3cc(Br)c(Br)c(N(OCCc4c(Cl)ccc(F)c4Cl)c4ccccn4)c3OC(F)(F)F)c2OC(F)(F)F)c1Cl |
| InChI | InChI=1S/C40H22BBr4Cl4F8N4O6/c42-21-17-27(37(64-39(52,53)54)35(31(21)44)60(29-5-1-3-13-58-29)62-15-11-19-23(46)7-9-25(50)33(19)48)66-41-67-28-18-22(43)32(45)36(38(28)65-40(55,56)57)61(30-6-2-4-14-59-30)63-16-12-20-24(47)8-10-26(51)34(20)49/h1-10,13-14,17-18H,11-12,15-16H2 |
| InChIKey | JEJVHIHPTXHCIS-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1278.86 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|