C20H14Cl2FN3O2 — CID 90937526
7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridin-2-ylfuro[3,2-c]pyridin-6-amine (PubChem CID 90937526) has the molecular formula C20H14Cl2FN3O2 and a molecular weight of 418.26 g/mol. Its IUPAC name is 7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridin-2-ylfuro[3,2-c]pyridin-6-amine.
| Compound Name | 7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridin-2-ylfuro[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 90937526 |
| Molecular Formula | C20H14Cl2FN3O2 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridin-2-ylfuro[3,2-c]pyridin-6-amine |
| SMILES | Nc1ncc2c(-c3ccccn3)coc2c1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H14Cl2FN3O2/c21-14-4-5-15(23)17(22)11(14)6-8-27-19-18-12(9-26-20(19)24)13(10-28-18)16-3-1-2-7-25-16/h1-5,7,9-10H,6,8H2,(H2,24,26) |
| InChIKey | WTKFVQWRPDSVKT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|