C19H14Cl2FN3O2 — CID 76618458
7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-(1H-pyrrol-2-yl)furo[3,2-c]pyridin-6-amine (PubChem CID 76618458) has the molecular formula C19H14Cl2FN3O2 and a molecular weight of 406.24 g/mol. Its IUPAC name is 7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-(1H-pyrrol-2-yl)furo[3,2-c]pyridin-6-amine.
| Compound Name | 7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-(1H-pyrrol-2-yl)furo[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 76618458 |
| Molecular Formula | C19H14Cl2FN3O2 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-(1H-pyrrol-2-yl)furo[3,2-c]pyridin-6-amine |
| SMILES | CC(Oc1c(N)ncc2c(-c3ccc[nH]3)coc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H14Cl2FN3O2/c1-9(15-12(20)4-5-13(22)16(15)21)27-18-17-10(7-25-19(18)23)11(8-26-17)14-3-2-6-24-14/h2-9,24H,1H3,(H2,23,25) |
| InChIKey | LXESBNKNLCITDM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|